4-Trifluoromethylphenylboronic acid, 99.99%
cas: 128796-39-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
4-Trifluoromethylphenylboronic acid, 99.99% (CAS 128796-39-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10 g, 50 g, 500 g, 100 g, 25 g. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-77738-10 g |
| cas | 128796-39-4 |
| opakowanie | 10 g |
| dostępność | In stock |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10 g | 240,74 Pln | |
| MedChemExpress | 50 g | 505,45 Pln | |
| MedChemExpress | 500 g | 2014,75 Pln | |
| MedChemExpress | 100 g | 733,01 Pln | |
| MedChemExpress | 25 g | 361,49 Pln |
właściwości
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 99.99% |
[4-(trifluoromethyl)phenyl]boronic acid (CAS 128796-39-4) to związek chemiczny o wzorze sumarycznym C7H6BF3O2 i masie molowej 189.93 g/mol. Nazwa systematyczna IUPAC: [4-(trifluoromethyl)phenyl]boronic acid. InChIKey: ALMFIOZYDASRRC-UHFFFAOYSA-N.
| Wzór sumaryczny | C7H6BF3O2 |
|---|---|
| Masa molowa | 189.93 g/mol |
| Nazwa IUPAC | [4-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | ALMFIOZYDASRRC-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(F)(F)F)(O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
4-(Trifluoromethyl)phenylboronic acid, 4-trifluoromethylphenylboronic acid, (4-(trifluoromethyl)phenyl)boronic acid, [4-(Trifluoromethyl)phenyl]boronic acid, 4-(Trifluoromethyl)benzeneboronic acid, (4-Trifluoromethylphenyl)boronic acid, alpha,alpha,alpha-Trifluoro-p-tolylboronic acid, 4-trifluormethylphenylboronic acid, 4-trifluoromethylbenzeneboronic acid, 4-(trifluoromethylphenyl)boronic acid