4-Vinylidenebis(N,N-dimethylaniline), 97%
cas: 7478-69-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
4-Vinylidenebis(N,N-dimethylaniline), 97% (CAS 7478-69-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g. Oferty producentów: Ambeed, Chemat, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A182938-250mg |
| cas | 7478-69-5 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 231,31 Pln | |
| Ambeed | 1g | 387,06 Pln | |
| Ambeed | 5g | 1332,69 Pln | |
| Chemat | 250mg | 222,80 Pln | |
| Chemat | 1g | 371,60 Pln | |
| Chemat | 5g | 1403,60 Pln | |
| BLDpharm | 250mg | 225,50 Pln | |
| BLDpharm | 1g | 414,32 Pln | |
| BLDpharm | 5g | 1436,19 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 1-2 tygodnie |
4-[1-[4-(dimethylamino)phenyl]ethenyl]-N,N-dimethylaniline (CAS 7478-69-5) to związek chemiczny o wzorze sumarycznym C18H22N2 i masie molowej 266.4 g/mol. Nazwa systematyczna IUPAC: 4-[1-[4-(dimethylamino)phenyl]ethenyl]-N,N-dimethylaniline. InChIKey: HBWITNNIJDLPLS-UHFFFAOYSA-N.
| Wzór sumaryczny | C18H22N2 |
|---|---|
| Masa molowa | 266.4 g/mol |
| Nazwa IUPAC | 4-[1-[4-(dimethylamino)phenyl]ethenyl]-N,N-dimethylaniline |
| InChIKey | HBWITNNIJDLPLS-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C(=C)C2=CC=C(C=C2)N(C)C |
Dane obliczone przez PubChem (NCBI)
Synonimy:
4,4'-Vinylidenebis(N,N-dimethylaniline), Michler's ethylene, 1,1-Bis(4-dimethylaminophenyl)ethylene, Bis(p-dimethylaminophenyl)-1,1 ethylene, 1,1-Bis(p-(dimethylamino)phenyl)ethylene, Aniline, 4,4'-vinylidenebis(N,N-dimethyl-, 4,4'-Ethenylidenebis(N,N-dimethylbenzenamine), Benzenamine, 4,4'-ethenylidenebis(N,N-dimethyl-, Benzenamine, 4,4'-ethenylidenebis[N,N-dimethyl-, 1,1-Bis((p-dimethylamino)phenyl)ethene
