cas: 140-66-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
4-tert-Octylphenol, 99.70% (CAS 140-66-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 25 g, 100 g, 500 g, 10mM/1mL, 50 g, 1000 g, 250 g. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-B1941-25 g |
| cas | 140-66-9 |
| opakowanie | 25 g |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 25 g | 240,74 Pln | |
| MedChemExpress | 100 g | 291,83 Pln | |
| MedChemExpress | 500 g | 384,71 Pln | |
| MedChemExpress | 10mM/1mL | 250,03 Pln | |
| MedChemExpress | 50 g | 263,96 Pln | |
| MedChemExpress | 1000 g | 435,79 Pln | |
| MedChemExpress | 250 g | 342,91 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.70% |
4-(2,4,4-trimethylpentan-2-yl)phenol (CAS 140-66-9) to związek chemiczny o wzorze sumarycznym C14H22O i masie molowej 206.32 g/mol. Nazwa systematyczna IUPAC: 4-(2,4,4-trimethylpentan-2-yl)phenol. InChIKey: ISAVYTVYFVQUDY-UHFFFAOYSA-N.
| Wzór sumaryczny | C14H22O |
|---|---|
| Masa molowa | 206.32 g/mol |
| Nazwa IUPAC | 4-(2,4,4-trimethylpentan-2-yl)phenol |
| InChIKey | ISAVYTVYFVQUDY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(C)(C)C1=CC=C(C=C1)O |
Dane obliczone przez PubChem (NCBI)