5(6)-Carboxyfluorescein, 97%
cas: 72088-94-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
5(6)-Carboxyfluorescein, 97% (CAS 72088-94-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 10g, 25g, 50g, 250g, 500g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11IKJ5-250mg |
| cas | 72088-94-9 |
| opakowanie | 250mg |
| dostępność | 1000g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 88,40 Pln | |
| Chemat | 1g | 136,40 Pln | |
| Chemat | 5g | 376,40 Pln | |
| Chemat | 10g | 626,00 Pln | |
| Chemat | 25g | 1370,00 Pln | |
| Chemat | 50g | 2406,80 Pln | |
| Chemat | 250g | 3006,80 Pln | |
| Chemat | 500g | 5289,60 Pln | |
| Chemat | 1kg | 7557,20 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid;3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid (CAS 72088-94-9) to związek chemiczny o wzorze sumarycznym C42H24O14 i masie molowej 752.6 g/mol. Nazwa systematyczna IUPAC: 3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid;3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid. InChIKey: BPVHBBXCESDRKW-UHFFFAOYSA-N.
| Wzór sumaryczny | C42H24O14 |
|---|---|
| Masa molowa | 752.6 g/mol |
| Nazwa IUPAC | 3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid;3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid |
| InChIKey | BPVHBBXCESDRKW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)C3(C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O)OC2=O.C1=CC2=C(C=C1C(=O)O)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
5(6)-carboxyfluorescein, 3',6'-Dihydroxy-3-oxo-3H-spiro[isobenzofuran-1,9'-xanthene]-5(6)-carboxylic acid, 5-(and-6)-carboxyfluorescein, 5(6)-Carboxyfluorescein, mixture of isomers, BPVHBBXCESDRKW-UHFFFAOYSA-N, 5-(and-6)-FAM, orb1217701, orb1307247, 5(6)-Carboxyfluorescein - mixture, 5(6)-Carboxyfluorescein, Dye content 90 %
