5(or 6)-carboxy-4-hexylcyclohex-2-ene-1-octanoic acid
cas: 53980-88-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
5(or 6)-carboxy-4-hexylcyclohex-2-ene-1-octanoic acid (CAS 53980-88-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100g, 500g, 2.5kg. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11DE8E-100g |
| cas | 53980-88-4 |
| opakowanie | 100g |
| dostępność | 2500g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100g | 179,60 Pln | |
| Chemat | 500g | 499,20 Pln | |
| Chemat | 2.5kg | 1351,20 Pln |
właściwości
| czas dostawy | 3 tygodnie |
|---|
5-(7-carboxyheptyl)-2-hexylcyclohex-3-ene-1-carboxylic acid (CAS 53980-88-4) to związek chemiczny o wzorze sumarycznym C21H36O4 i masie molowej 352.5 g/mol. Nazwa systematyczna IUPAC: 5-(7-carboxyheptyl)-2-hexylcyclohex-3-ene-1-carboxylic acid. InChIKey: RYKIXDBAIYMFDV-UHFFFAOYSA-N.
| Wzór sumaryczny | C21H36O4 |
|---|---|
| Masa molowa | 352.5 g/mol |
| Nazwa IUPAC | 5-(7-carboxyheptyl)-2-hexylcyclohex-3-ene-1-carboxylic acid |
| InChIKey | RYKIXDBAIYMFDV-UHFFFAOYSA-N |
| SMILES | CCCCCCC1C=CC(CC1C(=O)O)CCCCCCCC(=O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Cyclocarboxypropyloleic acid, 5(Or 6)-carboxy-4-hexylcyclohex-2-ene-1-octanoic acid, C21-Dicarboxylic acid, 5(or 6)-Carboxy-4-hexyl-2-cyclohexene-1-octanoic acid, 2-Cyclohexene-1-octanoic acid, 5(or 6)-carboxy-4-hexyl-, ACRYLINOLEIC ACID, CYCLOCARBOXYPROPYLOLEIC ACID [INCI], 5-Carboxy-4-hexyl-2-cyclohexene-1-octanoic acid, 2-cyclohexene-1-octanoic acid, 5-carboxy-4-hexyl-, 1-Carboxy-2-hexyl-5-(7-carboxyheptyl)cyclohex-3-ene