cas: 845673-97-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
5,6-DiHETE, 97.00% (CAS 845673-97-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10 mg, 25 mg, 50 mg, 500 μg, 1 mg, 5 mg, 10mM/1mL. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-130138C-10 mg |
| cas | 845673-97-4 |
| opakowanie | 10 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10 mg | 7986,94 Pln | |
| MedChemExpress | 25 mg | 15853,87 Pln | |
| MedChemExpress | 50 mg | 25309,06 Pln | |
| MedChemExpress | 500 μg | 1308,86 Pln | |
| MedChemExpress | 1 mg | 2014,75 Pln | |
| MedChemExpress | 5 mg | 4870,81 Pln | |
| MedChemExpress | 10mM/1mL | 3635,51 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 97.00% |
(8Z,11Z,14Z,17Z)-5,6-dihydroxyicosa-8,11,14,17-tetraenoic acid (CAS 845673-97-4) to związek chemiczny o wzorze sumarycznym C20H32O4 i masie molowej 336.5 g/mol. Nazwa systematyczna IUPAC: (8Z,11Z,14Z,17Z)-5,6-dihydroxyicosa-8,11,14,17-tetraenoic acid. InChIKey: VPXVODYVPILPRC-LTKCOYKYSA-N.
| Wzór sumaryczny | C20H32O4 |
|---|---|
| Masa molowa | 336.5 g/mol |
| Nazwa IUPAC | (8Z,11Z,14Z,17Z)-5,6-dihydroxyicosa-8,11,14,17-tetraenoic acid |
| InChIKey | VPXVODYVPILPRC-LTKCOYKYSA-N |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CC(C(CCCC(=O)O)O)O |
Dane obliczone przez PubChem (NCBI)