cas: 560088-89-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
5,8,14,17-Tetraoxa-2,11-diazanonadecanedioic acid, 10-oxo-, 1-(9H-fluoren-9-ylmethyl) ester, 95%, 95% (CAS 560088-89-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 250g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11DIEY-100mg |
| cas | 560088-89-3 |
| opakowanie | 100mg |
| dostępność | 1000g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 122,00 Pln | |
| Chemat | 250mg | 131,60 Pln | |
| Chemat | 1g | 232,40 Pln | |
| Chemat | 5g | 405,20 Pln | |
| Chemat | 10g | 683,60 Pln | |
| Chemat | 25g | 1096,40 Pln | |
| Chemat | 50g | 1782,80 Pln | |
| Chemat | 250g | 3006,80 Pln | |
| Chemat | 500g | 5366,40 Pln | |
| Chemat | 1kg | 10509,20 Pln |
| czystość | 95% |
|---|---|
| czas dostawy | 3 tygodnie |
2-[2-[2-[[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]acetyl]amino]ethoxy]ethoxy]acetic acid (CAS 560088-89-3) to związek chemiczny o wzorze sumarycznym C27H34N2O9 i masie molowej 530.6 g/mol. Nazwa systematyczna IUPAC: 2-[2-[2-[[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]acetyl]amino]ethoxy]ethoxy]acetic acid. InChIKey: DYLGYEMUUDYFSV-UHFFFAOYSA-N.
| Wzór sumaryczny | C27H34N2O9 |
|---|---|
| Masa molowa | 530.6 g/mol |
| Nazwa IUPAC | 2-[2-[2-[[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]acetyl]amino]ethoxy]ethoxy]acetic acid |
| InChIKey | DYLGYEMUUDYFSV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCOCC(=O)NCCOCCOCC(=O)O |
Dane obliczone przez PubChem (NCBI)