5-(tert-Butyl)-2-iodo-1,3-dimethylbenzene, 97%, 97%
cas: 5122-20-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
5-(tert-Butyl)-2-iodo-1,3-dimethylbenzene, 97%, 97% (CAS 5122-20-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 10g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11456V-100mg |
| cas | 5122-20-3 |
| opakowanie | 100mg |
| dostępność | 17g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 131,60 Pln | |
| Chemat | 250mg | 170,00 Pln | |
| Chemat | 1g | 410,00 Pln | |
| Chemat | 5g | 1077,20 Pln | |
| Chemat | 10g | 2090,00 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
5-tert-butyl-2-iodo-1,3-dimethylbenzene (CAS 5122-20-3) to związek chemiczny o wzorze sumarycznym C12H17I i masie molowej 288.17 g/mol. Nazwa systematyczna IUPAC: 5-tert-butyl-2-iodo-1,3-dimethylbenzene. InChIKey: SCKWYPTZVFBKKW-UHFFFAOYSA-N.
| Wzór sumaryczny | C12H17I |
|---|---|
| Masa molowa | 288.17 g/mol |
| Nazwa IUPAC | 5-tert-butyl-2-iodo-1,3-dimethylbenzene |
| InChIKey | SCKWYPTZVFBKKW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1I)C)C(C)(C)C |
Dane obliczone przez PubChem (NCBI)
Synonimy:
5-tert-butyl-2-iodo-1,3-dimethylbenzene, 4-tert-Butyl-2,6-dimethyliodobenzene, Maybridge4_003980, Triisopropanloamine, 5-(tert-Butyl)-2-iodo-1,3-dimeth, 5-Tert-Butyl-2-Iodo-1,3-DiMethyl-Benzene, 5-(t-Butyl)-2-iodo-1,3-dimethylbenzene, 5-tert-Butyl-2-iodo-1,3-dimethylbenzene, 97%,, Benzene, 5-(1,1-dimethylethyl)-2-iodo-1,3-dimethyl-