5-Fluoro-2-methyl-1H-indene-3-acetic acid, 98%, 98%
cas: 32004-66-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
5-Fluoro-2-methyl-1H-indene-3-acetic acid, 98%, 98% (CAS 32004-66-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 10g, 25g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch1143UY-100mg |
| cas | 32004-66-3 |
| opakowanie | 100mg |
| dostępność | 50g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 88,40 Pln | |
| Chemat | 250mg | 98,00 Pln | |
| Chemat | 1g | 165,20 Pln | |
| Chemat | 5g | 539,60 Pln | |
| Chemat | 10g | 933,20 Pln | |
| Chemat | 25g | 2234,00 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
2-(6-fluoro-2-methyl-3H-inden-1-yl)acetic acid (CAS 32004-66-3) to związek chemiczny o wzorze sumarycznym C12H11FO2 i masie molowej 206.21 g/mol. Nazwa systematyczna IUPAC: 2-(6-fluoro-2-methyl-3H-inden-1-yl)acetic acid. InChIKey: QDDPPRDVFIJASZ-UHFFFAOYSA-N.
| Wzór sumaryczny | C12H11FO2 |
|---|---|
| Masa molowa | 206.21 g/mol |
| Nazwa IUPAC | 2-(6-fluoro-2-methyl-3H-inden-1-yl)acetic acid |
| InChIKey | QDDPPRDVFIJASZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C1)C=CC(=C2)F)CC(=O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
5-Fluoro-2-methyl-1H-indene-3-acetic acid, 2-(6-fluoro-2-methyl-3H-inden-1-yl)acetic acid, 5-Fluoro-2-methylindene-3-acetic acid, 1H-Indene-3-acetic acid, 5-fluoro-2-methyl-, (5-fluoro-2-methyl-1H-inden-3-yl)acetic acid, 2-(5-fluoro-2-methyl-1H-inden-3-yl)acetic acid, 2-(5-Fluoro-2-methyl-3-indenyl)acetic Acid, 5-fluoro-2-methyl-3-indenyl-acetic acid, 5-fluoro-2-methyl-3-indenylacetic acid, 5-fluoro-2-methylinden-3-yl acetic acid