5-Methoxyindole-3-acetic acid, 99.63%
cas: 3471-31-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
5-Methoxyindole-3-acetic acid, 99.63% (CAS 3471-31-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1 g, 500 mg, 100 mg, 10mM/1mL. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-W007566-1 g |
| cas | 3471-31-6 |
| opakowanie | 1 g |
| dostępność | In stock |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 1 g | 505,45 Pln | |
| MedChemExpress | 500 mg | 361,49 Pln | |
| MedChemExpress | 100 mg | 240,74 Pln | |
| MedChemExpress | 10mM/1mL | 250,03 Pln |
właściwości
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 99.63% |
2-(5-methoxy-1H-indol-3-yl)acetic acid (CAS 3471-31-6) to związek chemiczny o wzorze sumarycznym C11H11NO3 i masie molowej 205.21 g/mol. Nazwa systematyczna IUPAC: 2-(5-methoxy-1H-indol-3-yl)acetic acid. InChIKey: COCNDHOPIHDTHK-UHFFFAOYSA-N.
| Wzór sumaryczny | C11H11NO3 |
|---|---|
| Masa molowa | 205.21 g/mol |
| Nazwa IUPAC | 2-(5-methoxy-1H-indol-3-yl)acetic acid |
| InChIKey | COCNDHOPIHDTHK-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC=C2CC(=O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
5-Methoxyindole-3-acetic acid, 2-(5-methoxy-1H-indol-3-yl)acetic acid, 5-Methoxyindoleacetic acid, Methoxyindoleacetic acid, 5-Methoxy-3-indoleacetic acid, 5-Methoxyindoleacetate, 5-Methoxyindol-3-ylacetic acid, 1H-Indole-3-acetic acid, 5-methoxy-, (5-Methoxy-1H-indol-3-yl)acetic acid, 5-Methoxyindole-3-aceticacid