5-Nitrobenzofuran-2-carboxylic acid, 99.96%
cas: 10242-12-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
5-Nitrobenzofuran-2-carboxylic acid, 99.96% (CAS 10242-12-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1 g, 5 g, 250 mg, 500 mg, 10 g. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-Z0540-1 g |
| cas | 10242-12-3 |
| opakowanie | 1 g |
| dostępność | In stock |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 1 g | 505,45 Pln | |
| MedChemExpress | 5 g | 1081,31 Pln | |
| MedChemExpress | 250 mg | 273,25 Pln | |
| MedChemExpress | 500 mg | 361,49 Pln | |
| MedChemExpress | 10 g | 1633,94 Pln |
właściwości
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 99.96% |
5-nitro-1-benzofuran-2-carboxylic acid (CAS 10242-12-3) to związek chemiczny o wzorze sumarycznym C9H5NO5 i masie molowej 207.14 g/mol. Nazwa systematyczna IUPAC: 5-nitro-1-benzofuran-2-carboxylic acid. InChIKey: LZKWLHXJPIKJSJ-UHFFFAOYSA-N.
| Wzór sumaryczny | C9H5NO5 |
|---|---|
| Masa molowa | 207.14 g/mol |
| Nazwa IUPAC | 5-nitro-1-benzofuran-2-carboxylic acid |
| InChIKey | LZKWLHXJPIKJSJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C=C(O2)C(=O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
5-Nitrobenzofuran-2-carboxylic acid, 5-nitro-1-benzofuran-2-carboxylic acid, 2-Benzofurancarboxylic acid, 5-nitro-, 5-Nitro-benzofuran-2-carboxylic acid, 5-nitrobenzo[b]furan-2-carboxylic acid, 5-nitrocoumarone-2-carboxylic acid, 2-carboxy-5-nitrobenzofuran, 5-nitro-2-benzofurancarboxylic acid, orb3181427, 5-Nitrobenzofuran-2-carboxylicacid