5-Oxo-5-(thiophen-2-yl)pentanoic acid, 98%
cas: 22971-62-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
5-Oxo-5-(thiophen-2-yl)pentanoic acid, 98% (CAS 22971-62-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 25g, 1g, 5g, 10g. Oferty producentów: AmBeed.
| producent | AmBeed |
|---|---|
| nr katalogowy | A378650-25g |
| cas | 22971-62-6 |
| opakowanie | 25g |
| dostępność | Synthetic Items: 0g |
Dokumenty:
Karta charakterystyki (MSDS)
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| AmBeed | 25g | 1300,39 Pln | |
| Ambeed | 1g | 220,19 Pln | |
| Ambeed | 5g | 548,38 Pln | |
| Ambeed | 10g | 882,12 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | Do potwierdzenia przez Chemat |
5-oxo-5-thiophen-2-ylpentanoic acid (CAS 22971-62-6) to związek chemiczny o wzorze sumarycznym C9H10O3S i masie molowej 198.24 g/mol. Nazwa systematyczna IUPAC: 5-oxo-5-thiophen-2-ylpentanoic acid. InChIKey: GSQMRVFOHNXKOR-UHFFFAOYSA-N.
| Wzór sumaryczny | C9H10O3S |
|---|---|
| Masa molowa | 198.24 g/mol |
| Nazwa IUPAC | 5-oxo-5-thiophen-2-ylpentanoic acid |
| InChIKey | GSQMRVFOHNXKOR-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(=O)CCCC(=O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
5-Oxo-5-(thiophen-2-yl)pentanoic acid, 5-Oxo-5-(2-thienyl)valeric acid, 4-(2-thienoyl)butyric acid, 5-oxo-5-thiophen-2-ylpentanoic acid, 5-oxo-5-(2-thienyl)pentanoic acid, 2-Thiophenepentanoic acid, delta-oxo-, 5-Oxo-5-(thiophen-2-yl)pentanoicacid, 5-(thien-2-yl)-5-oxopentanoic acid, 5-oxo-5-thien-2-ylpentanoic acid, 4-(2-thenoyl)butyric acid