cas: 91809-66-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
5-TAMRA, 98.98% (CAS 91809-66-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10mM/1mL, 100 mg, 25 mg, 50 mg, 5 mg, 10 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-15942-10mM/1mL |
| cas | 91809-66-4 |
| opakowanie | 10mM/1mL |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 287,18 Pln | |
| MedChemExpress | 100 mg | 928,06 Pln | |
| MedChemExpress | 25 mg | 533,32 Pln | |
| MedChemExpress | 50 mg | 695,86 Pln | |
| MedChemExpress | 5 mg | 273,25 Pln | |
| MedChemExpress | 10 mg | 352,20 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 98.98% |
3-carboxy-4-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]benzoate (CAS 91809-66-4) to związek chemiczny o wzorze sumarycznym C25H22N2O5 i masie molowej 430.5 g/mol. Nazwa systematyczna IUPAC: 3-carboxy-4-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]benzoate. InChIKey: YMZMTOFQCVHHFB-UHFFFAOYSA-N.
| Wzór sumaryczny | C25H22N2O5 |
|---|---|
| Masa molowa | 430.5 g/mol |
| Nazwa IUPAC | 3-carboxy-4-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]benzoate |
| InChIKey | YMZMTOFQCVHHFB-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](C)C)C=C3O2)C4=C(C=C(C=C4)C(=O)[O-])C(=O)O |
Dane obliczone przez PubChem (NCBI)