6-Carboxyfluorescein, 98%
cas: 3301-79-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
6-Carboxyfluorescein, 98% (CAS 3301-79-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 100mg, 250mg, 500mg, 1g, 5g, 10g, 15g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch1149TE-1mg |
| cas | 3301-79-9 |
| opakowanie | 1mg |
| dostępność | 1000g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 1mg | 88,40 Pln | |
| Chemat | 100mg | 107,60 Pln | |
| Chemat | 250mg | 155,60 Pln | |
| Chemat | 500mg | 194,00 Pln | |
| Chemat | 1g | 285,20 Pln | |
| Chemat | 5g | 971,60 Pln | |
| Chemat | 10g | 1845,20 Pln | |
| Chemat | 15g | 2656,40 Pln | |
| Chemat | 25g | 3558,80 Pln | |
| Chemat | 250g | 18515,60 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid (CAS 3301-79-9) to związek chemiczny o wzorze sumarycznym C21H12O7 i masie molowej 376.3 g/mol. Nazwa systematyczna IUPAC: 3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid. InChIKey: BZTDTCNHAFUJOG-UHFFFAOYSA-N.
| Wzór sumaryczny | C21H12O7 |
|---|---|
| Masa molowa | 376.3 g/mol |
| Nazwa IUPAC | 3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid |
| InChIKey | BZTDTCNHAFUJOG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)C3(C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O)OC2=O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
6-Carboxyfluorescein, FLUOS, 3',6'-dihydroxy-3-oxo-3H-spiro[isobenzofuran-1,9'-xanthene]-6-carboxylic acid, 5(6)-carboxy fluorescein, 3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid, 3',6'-dihydroxy-3-oxo-3H-spiro[2-benzofuran-1,9'-xanthene]-6-carboxylic acid, Spiro[isobenzofur, (3,6,9-Trihydroxyxanthen-9-yl)terephthalic Acid, Fluorescein Impurity 35, orb1307239