6-Methyleneandrost-4-ene-3,17-dione, 97%, 97%
cas: 19457-55-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
6-Methyleneandrost-4-ene-3,17-dione, 97%, 97% (CAS 19457-55-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 10g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch1185KV-250mg |
| cas | 19457-55-7 |
| opakowanie | 250mg |
| dostępność | 20g |
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 78,80 Pln | |
| Chemat | 1g | 88,40 Pln | |
| Chemat | 5g | 141,20 Pln | |
| Chemat | 10g | 198,80 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
(8R,9S,10R,13S,14S)-10,13-dimethyl-6-methylidene-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione (CAS 19457-55-7) to związek chemiczny o wzorze sumarycznym C20H26O2 i masie molowej 298.4 g/mol. Nazwa systematyczna IUPAC: (8R,9S,10R,13S,14S)-10,13-dimethyl-6-methylidene-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione. InChIKey: KQRGETZTRARSMA-DAELLWKTSA-N.
| Wzór sumaryczny | C20H26O2 |
|---|---|
| Masa molowa | 298.4 g/mol |
| Nazwa IUPAC | (8R,9S,10R,13S,14S)-10,13-dimethyl-6-methylidene-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione |
| InChIKey | KQRGETZTRARSMA-DAELLWKTSA-N |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CC(=C)C4=CC(=O)CC[C@]34C |
Dane obliczone przez PubChem (NCBI)
Synonimy:
6-methyleneandrost-4-ene-3,17-dione, 1,2-Dihydro Exemestane, Exemestane EP Impurity E, 6-Methylideneandrost-4-ene-3,17-dione, 6-Methyleneandrost-4-en-3,17-dione, KQRGETZTRARSMA-DAELLWKTSA-N, 6-methylenandrost-4-en-3,17-dione, 6-methylenandrost-4-ene-3,17-dione, 6-Methylen-androst-4-ene-3,17-dione, 6-methylene-androst-4-ene-3,17-dione