7-(Trifluoromethyl)isatin, 98%
cas: 391-12-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
7-(Trifluoromethyl)isatin, 98% (CAS 391-12-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch114NC0-1g |
| cas | 391-12-8 |
| opakowanie | 1g |
| dostępność | 1000g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 1g | 78,80 Pln | |
| Chemat | 5g | 93,20 Pln | |
| Chemat | 10g | 122,00 Pln | |
| Chemat | 25g | 198,80 Pln | |
| Chemat | 50g | 333,20 Pln | |
| Chemat | 100g | 587,60 Pln | |
| Chemat | 250g | 1355,60 Pln | |
| Chemat | 500g | 2673,60 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
7-(trifluoromethyl)-1H-indole-2,3-dione (CAS 391-12-8) to związek chemiczny o wzorze sumarycznym C9H4F3NO2 i masie molowej 215.13 g/mol. Nazwa systematyczna IUPAC: 7-(trifluoromethyl)-1H-indole-2,3-dione. InChIKey: MXLDJTXXAYVWDF-UHFFFAOYSA-N.
| Wzór sumaryczny | C9H4F3NO2 |
|---|---|
| Masa molowa | 215.13 g/mol |
| Nazwa IUPAC | 7-(trifluoromethyl)-1H-indole-2,3-dione |
| InChIKey | MXLDJTXXAYVWDF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C(F)(F)F)NC(=O)C2=O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
7-Trifluoromethylisatin, 7-(Trifluoromethyl)isatin, 7-(Trifluoromethyl)-1H-indole-2,3-dione, 7-(Trifluoromethyl)indoline-2,3-dione, 7-(trifluoromethyl)-2,3-dihydro-1h-indole-2,3-dione, 7-trifluoromethyl-1h-indole-2,3-dione, 7-(trifluoromethyl)1h-indole-2,3-dione, 7-trifluoromethyl indoline-2,3-dione, 7-(trifluoromethyl)-1~{H}-indole-2,3-dione, 7-(Trifluoromethyl)indole-2,3-dione