8-Cyclopentyl-1,3-dimethylxanthine 99%
cas: 35873-49-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
8-Cyclopentyl-1,3-dimethylxanthine 99% (CAS 35873-49-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Oferty producentów: Ambeed.
| producent | Ambeed |
|---|---|
| nr katalogowy | A419006-5mg |
| cas | 35873-49-5 |
| opakowanie | 5mg |
Dokumenty:
Karta charakterystyki (MSDS)
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 5mg | 186,81 Pln | |
| Ambeed | 10mg | 231,31 Pln | |
| Ambeed | 25mg | 437,12 Pln | |
| Ambeed | 50mg | 798,69 Pln | |
| Ambeed | 100mg | 1488,44 Pln | |
| Ambeed | 250mg | 2762,25 Pln |
właściwości
| czystość | 99% |
|---|---|
| czas dostawy | 2-3 tygodnie |
| nr katalogowy ambeed | A419006 |
8-cyclopentyl-1,3-dimethyl-7H-purine-2,6-dione (CAS 35873-49-5) to związek chemiczny o wzorze sumarycznym C12H16N4O2 i masie molowej 248.28 g/mol. Nazwa systematyczna IUPAC: 8-cyclopentyl-1,3-dimethyl-7H-purine-2,6-dione. InChIKey: SCVHFRLUNIOSGI-UHFFFAOYSA-N.
| Wzór sumaryczny | C12H16N4O2 |
|---|---|
| Masa molowa | 248.28 g/mol |
| Nazwa IUPAC | 8-cyclopentyl-1,3-dimethyl-7H-purine-2,6-dione |
| InChIKey | SCVHFRLUNIOSGI-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)NC(=N2)C3CCCC3 |
Dane obliczone przez PubChem (NCBI)
Synonimy:
8-Cyclopentyl-1,3-dimethylxanthine, 8-cyclopentyltheophylline, 8-cyclopentyl-1,3-dimethyl-7H-purine-2,6-dione, 1,3-dimethyl-8-cyclopentylxanthine, 1H-Purine-2,6-dione, 8-cyclopentyl-3,7-dihydro-1,3-dimethyl-, 8-Cyclopentyl-1,3-dimethyl-1H-purine-2,6(3H,7H)-dione, 8-Cyclopentyl-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione, 8-Cyclopentyl theophylline, Xanthine, 8-cyclopentyl-1,3-dimethyl-, Theophylline, 8-cyclopentyl-