9,10-Diphenylanthracene, 98%
cas: 1499-10-1 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
9,10-Diphenylanthracene, 98% (CAS 1499-10-1) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1g, 5g, 25g, 10g, 50g. Oferty producentów: Thermo Scientific (Acros), Chemat.
| producent | Thermo Scientific (Acros) |
|---|---|
| nr katalogowy | 117200010 |
| cas | 1499-10-1 |
| opakowanie | 1g |
| dostępność | dostępność |
Dokumenty:
Karta charakterystyki (MSDS)
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 327,85 Pln | |
| Thermo Scientific (Acros) | 5g | 1015,61 Pln | |
| Thermo Scientific (Acros) | 25g | 2672,67 Pln | |
| Chemat | 5g | 122,00 Pln | |
| Chemat | 10g | 170,00 Pln | |
| Chemat | 25g | 275,60 Pln | |
| Chemat | 50g | 482,00 Pln |
właściwości
| czas dostawy | 2-3 tygodnie |
|---|---|
| kategoria | Chemicals |
| czystość | 98% |
9,10-diphenylanthracene (CAS 1499-10-1) to związek chemiczny o wzorze sumarycznym C26H18 i masie molowej 330.4 g/mol. Nazwa systematyczna IUPAC: 9,10-diphenylanthracene. InChIKey: FCNCGHJSNVOIKE-UHFFFAOYSA-N.
| Wzór sumaryczny | C26H18 |
|---|---|
| Masa molowa | 330.4 g/mol |
| Nazwa IUPAC | 9,10-diphenylanthracene |
| InChIKey | FCNCGHJSNVOIKE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3C=CC=CC3=C(C4=CC=CC=C42)C5=CC=CC=C5 |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Anthracene, 9,10-diphenyl-, 9,10-diphenyl anthracene, Anthracene,10-diphenyl-, 9,10-Diphenyl-anthracen, 9,10-Diphenylanthracene, 97%, 9,10-Diphenylanthracene, analytical standard, 9,10-Diphenylanthracene, 98%, 9,10-Diphenylanthracene - 95%, 9,10-Diphenylanthracene - 99%, 9,10-Diphenylanthracene (purified by sublimation)