9,9'-Spirobifluorene-2-boronic Acid, 95%
cas: 236389-21-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
9,9'-Spirobifluorene-2-boronic Acid, 95% (CAS 236389-21-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 25g. Oferty producentów: Ambeed, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A194023-250mg |
| cas | 236389-21-2 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 125,62 Pln | |
| Ambeed | 1g | 136,75 Pln | |
| Ambeed | 5g | 348,12 Pln | |
| Ambeed | 25g | 971,12 Pln | |
| BLDpharm | 250mg | 125,54 Pln | |
| BLDpharm | 1g | 142,20 Pln | |
| BLDpharm | 5g | 369,89 Pln | |
| BLDpharm | 25g | 1041,88 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 1-2 tygodnie |
9,9'-spirobi[fluorene]-2-ylboronic acid (CAS 236389-21-2) to związek chemiczny o wzorze sumarycznym C25H17BO2 i masie molowej 360.2 g/mol. Nazwa systematyczna IUPAC: 9,9'-spirobi[fluorene]-2-ylboronic acid. InChIKey: WDDLHUWVLROJLA-UHFFFAOYSA-N.
| Wzór sumaryczny | C25H17BO2 |
|---|---|
| Masa molowa | 360.2 g/mol |
| Nazwa IUPAC | 9,9'-spirobi[fluorene]-2-ylboronic acid |
| InChIKey | WDDLHUWVLROJLA-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C3=CC=CC=C3C24C5=CC=CC=C5C6=CC=CC=C46)(O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
9,9'-Spirobi[9H-fluorene]-2-boronic Acid, 9,9'-Spirobi(9H-fluorene)-2-boronic Acid, 9,9'-Spirobi[fluoren]-2-ylboronic acid, 9,9'-spirobi[fluorene]-2-ylboronic acid, 9,9'-spirobifluorene-2-boronic acid, B-9,9'-Spirobi[9H-fluoren]-2'-yl-boronic acid, Boronic acid, B-9,9'-spirobi[9H-fluoren]-2'-yl-, Boronic acid, B-9,9'-spirobi[9H-fluoren]-2-yl-, 9,9 inverted exclamation mark -Spirobifluorene-2-boronic Acid, 9,9'-spirobi[fluorene]-2-ylboronic acid;9,9'-Spirobi[fluoren]-2-ylboronic acid