9-Phenanthreneboronic acid, 98%
cas: 68572-87-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
9-Phenanthreneboronic acid, 98% (CAS 68572-87-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch1145FB-100mg |
| cas | 68572-87-2 |
| opakowanie | 100mg |
| dostępność | 10000g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 74,00 Pln | |
| Chemat | 1g | 74,00 Pln | |
| Chemat | 5g | 83,60 Pln | |
| Chemat | 10g | 102,80 Pln | |
| Chemat | 25g | 165,20 Pln | |
| Chemat | 50g | 266,00 Pln | |
| Chemat | 100g | 467,60 Pln | |
| Chemat | 250g | 1072,40 Pln | |
| Chemat | 500g | 2155,20 Pln | |
| Chemat | 1kg | 3050,00 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
Phenanthren-9-ylboronic acid (CAS 68572-87-2) to związek chemiczny o wzorze sumarycznym C14H11BO2 i masie molowej 222.05 g/mol. Nazwa systematyczna IUPAC: phenanthren-9-ylboronic acid. InChIKey: JCDAUYWOHOLVMH-UHFFFAOYSA-N.
| Wzór sumaryczny | C14H11BO2 |
|---|---|
| Masa molowa | 222.05 g/mol |
| Nazwa IUPAC | phenanthren-9-ylboronic acid |
| InChIKey | JCDAUYWOHOLVMH-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=CC=CC=C2C3=CC=CC=C13)(O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
9-Phenanthracenylboronic acid, 9-Phenanthreneboronic Acid, Phenanthren-9-ylboronic Acid, Phenanthrene-9-boronic acid, 9-Phenanthreneboronicacid, 9-phenanthrenylboronic acid, 9-phenanthrene boronic acid, 9-phenanthrylboronic acid, 9-Phenanthreneboronic Acid (contains varying amounts of Anhydride), Boronic acid, 9-phenanthrenyl-
