cas: 1375466-18-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
ACY-775, 99.71% (CAS 1375466-18-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10 mg, 50 mg, 100 mg, 10mM/1mL, 5 mg, 25 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-19328-10 mg |
| cas | 1375466-18-4 |
| opakowanie | 10 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10 mg | 686,57 Pln | |
| MedChemExpress | 50 mg | 1907,94 Pln | |
| MedChemExpress | 100 mg | 2808,88 Pln | |
| MedChemExpress | 10mM/1mL | 505,45 Pln | |
| MedChemExpress | 5 mg | 468,30 Pln | |
| MedChemExpress | 25 mg | 1308,86 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.71% |
2-[[1-(3-fluorophenyl)cyclohexyl]amino]-N-hydroxypyrimidine-5-carboxamide (CAS 1375466-18-4) to związek chemiczny o wzorze sumarycznym C17H19FN4O2 i masie molowej 330.36 g/mol. Nazwa systematyczna IUPAC: 2-[[1-(3-fluorophenyl)cyclohexyl]amino]-N-hydroxypyrimidine-5-carboxamide. InChIKey: IYBURCQQEUNLDL-UHFFFAOYSA-N.
| Wzór sumaryczny | C17H19FN4O2 |
|---|---|
| Masa molowa | 330.36 g/mol |
| Nazwa IUPAC | 2-[[1-(3-fluorophenyl)cyclohexyl]amino]-N-hydroxypyrimidine-5-carboxamide |
| InChIKey | IYBURCQQEUNLDL-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C2=CC(=CC=C2)F)NC3=NC=C(C=N3)C(=O)NO |
Dane obliczone przez PubChem (NCBI)