cas: 256925-03-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
AL 082D06, 98.92% (CAS 256925-03-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10mM/1mL, 10 mg, 25 mg, 5 mg, 50 mg, 100 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-15709-10mM/1mL |
| cas | 256925-03-8 |
| opakowanie | 10mM/1mL |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 412,57 Pln | |
| MedChemExpress | 10 mg | 593,69 Pln | |
| MedChemExpress | 25 mg | 1123,10 Pln | |
| MedChemExpress | 5 mg | 384,71 Pln | |
| MedChemExpress | 50 mg | 1861,50 Pln | |
| MedChemExpress | 100 mg | 2442,00 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 98.92% |
4-[(2-chloro-5-nitrophenyl)-[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline (CAS 256925-03-8) to związek chemiczny o wzorze sumarycznym C23H24ClN3O2 i masie molowej 409.9 g/mol. Nazwa systematyczna IUPAC: 4-[(2-chloro-5-nitrophenyl)-[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline. InChIKey: IPICUXHYPAMJNC-UHFFFAOYSA-N.
| Wzór sumaryczny | C23H24ClN3O2 |
|---|---|
| Masa molowa | 409.9 g/mol |
| Nazwa IUPAC | 4-[(2-chloro-5-nitrophenyl)-[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline |
| InChIKey | IPICUXHYPAMJNC-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C(C2=CC=C(C=C2)N(C)C)C3=C(C=CC(=C3)[N+](=O)[O-])Cl |
Dane obliczone przez PubChem (NCBI)