cas: 853299-07-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
AUZ 454, 99.15% (CAS 853299-07-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5 mg, 10mM/1mL, 100 mg, 10 mg, 50 mg, 25 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-15004-5 mg |
| cas | 853299-07-7 |
| opakowanie | 5 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 5 mg | 551,89 Pln | |
| MedChemExpress | 10mM/1mL | 593,69 Pln | |
| MedChemExpress | 100 mg | 3575,14 Pln | |
| MedChemExpress | 10 mg | 811,96 Pln | |
| MedChemExpress | 50 mg | 2279,46 Pln | |
| MedChemExpress | 25 mg | 1559,64 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.15% |
1-[4-(2-aminopyrimidin-4-yl)oxyphenyl]-3-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]urea (CAS 853299-07-7) to związek chemiczny o wzorze sumarycznym C24H26F3N7O2 i masie molowej 501.5 g/mol. Nazwa systematyczna IUPAC: 1-[4-(2-aminopyrimidin-4-yl)oxyphenyl]-3-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]urea. InChIKey: PWDLXPJQFNVTNL-UHFFFAOYSA-N.
| Wzór sumaryczny | C24H26F3N7O2 |
|---|---|
| Masa molowa | 501.5 g/mol |
| Nazwa IUPAC | 1-[4-(2-aminopyrimidin-4-yl)oxyphenyl]-3-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]urea |
| InChIKey | PWDLXPJQFNVTNL-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CC2=C(C=C(C=C2)NC(=O)NC3=CC=C(C=C3)OC4=NC(=NC=C4)N)C(F)(F)F |
Dane obliczone przez PubChem (NCBI)