cas: 64506-49-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Acetic acid, 2-[5-[(3-methyl-2-buten-1-yl)oxy]-2-[3-[4-[(3-methyl-2-buten-1-yl)oxy]phenyl]-1-oxo-2-propen-1-yl]phenoxy]-, 97%, 97% (CAS 64506-49-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 50g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11IBDO-250mg |
| cas | 64506-49-6 |
| opakowanie | 250mg |
| dostępność | 990.5g |
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 83,60 Pln | |
| Chemat | 1g | 102,80 Pln | |
| Chemat | 5g | 136,40 Pln | |
| Chemat | 10g | 174,80 Pln | |
| Chemat | 25g | 246,80 Pln | |
| Chemat | 100g | 798,80 Pln | |
| Chemat | 500g | 3801,60 Pln | |
| Chemat | 50g | 429,20 Pln | |
| Chemat | 250g | 1902,80 Pln |
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
2-[5-(3-methylbut-2-enoxy)-2-[(E)-3-[4-(3-methylbut-2-enoxy)phenyl]prop-2-enoyl]phenoxy]acetic acid (CAS 64506-49-6) to związek chemiczny o wzorze sumarycznym C27H30O6 i masie molowej 450.5 g/mol. Nazwa systematyczna IUPAC: 2-[5-(3-methylbut-2-enoxy)-2-[(E)-3-[4-(3-methylbut-2-enoxy)phenyl]prop-2-enoyl]phenoxy]acetic acid. InChIKey: GFWRVVCDTLRWPK-KPKJPENVSA-N.
| Wzór sumaryczny | C27H30O6 |
|---|---|
| Masa molowa | 450.5 g/mol |
| Nazwa IUPAC | 2-[5-(3-methylbut-2-enoxy)-2-[(E)-3-[4-(3-methylbut-2-enoxy)phenyl]prop-2-enoyl]phenoxy]acetic acid |
| InChIKey | GFWRVVCDTLRWPK-KPKJPENVSA-N |
| SMILES | CC(=CCOC1=CC=C(C=C1)/C=C/C(=O)C2=C(C=C(C=C2)OCC=C(C)C)OCC(=O)O)C |
Dane obliczone przez PubChem (NCBI)