cas: 496868-77-0 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Adarotene, 99%, 99% (CAS 496868-77-0) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11DB5N-1mg |
| cas | 496868-77-0 |
| opakowanie | 1mg |
| dostępność | 0.5g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 1mg | 170,00 Pln | |
| Chemat | 5mg | 184,40 Pln | |
| Chemat | 10mg | 294,80 Pln | |
| Chemat | 25mg | 578,00 Pln | |
| Chemat | 50mg | 808,40 Pln | |
| Chemat | 100mg | 1370,00 Pln | |
| Chemat | 250mg | 2286,80 Pln |
| czystość | 99% |
|---|---|
| czas dostawy | 3 tygodnie |
(E)-3-[4-[3-(1-adamantyl)-4-hydroxyphenyl]phenyl]prop-2-enoic acid (CAS 496868-77-0) to związek chemiczny o wzorze sumarycznym C25H26O3 i masie molowej 374.5 g/mol. Nazwa systematyczna IUPAC: (E)-3-[4-[3-(1-adamantyl)-4-hydroxyphenyl]phenyl]prop-2-enoic acid. InChIKey: QAWBIEIZDDIEMW-FPYGCLRLSA-N.
| Wzór sumaryczny | C25H26O3 |
|---|---|
| Masa molowa | 374.5 g/mol |
| Nazwa IUPAC | (E)-3-[4-[3-(1-adamantyl)-4-hydroxyphenyl]phenyl]prop-2-enoic acid |
| InChIKey | QAWBIEIZDDIEMW-FPYGCLRLSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C4=C(C=CC(=C4)C5=CC=C(C=C5)/C=C/C(=O)O)O |
Dane obliczone przez PubChem (NCBI)