cas: 479200-82-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Amino-PEG11-amine, 95.0% (CAS 479200-82-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 50 mg, 100 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-130411-50 mg |
| cas | 479200-82-3 |
| opakowanie | 50 mg |
| dostępność | In stock |
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 50 mg | 375,42 Pln | |
| MedChemExpress | 100 mg | 528,67 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 95.0% |
2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine (CAS 479200-82-3) to związek chemiczny o wzorze sumarycznym C24H52N2O11 i masie molowej 544.7 g/mol. Nazwa systematyczna IUPAC: 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine. InChIKey: TZQCFDTWLKAGLL-UHFFFAOYSA-N.
| Wzór sumaryczny | C24H52N2O11 |
|---|---|
| Masa molowa | 544.7 g/mol |
| Nazwa IUPAC | 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine |
| InChIKey | TZQCFDTWLKAGLL-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN)N |
Dane obliczone przez PubChem (NCBI)