cas: 1345681-71-1 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Amino-PEG12-alcohol 95% (CAS 1345681-71-1) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10g, 100mg, 250mg, 1g, 5g. Oferty producentów: Ambeed.
| producent | Ambeed |
|---|---|
| nr katalogowy | A659821-10g |
| cas | 1345681-71-1 |
| opakowanie | 10g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 10g | 5009,50 Pln | |
| Ambeed | 100mg | 153,44 Pln | |
| Ambeed | 250mg | 225,75 Pln | |
| Ambeed | 1g | 693,00 Pln | |
| Ambeed | 5g | 3157,19 Pln |
| czystość | 95% |
|---|---|
| czas dostawy | 1-2 tygodnie |
| nr katalogowy ambeed | A659821 |
2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol (CAS 1345681-71-1) to związek chemiczny o wzorze sumarycznym C24H51NO12 i masie molowej 545.7 g/mol. Nazwa systematyczna IUPAC: 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol. InChIKey: JPIQEMLLJLGGFV-UHFFFAOYSA-N.
| Wzór sumaryczny | C24H51NO12 |
|---|---|
| Masa molowa | 545.7 g/mol |
| Nazwa IUPAC | 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
| InChIKey | JPIQEMLLJLGGFV-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO)N |
Dane obliczone przez PubChem (NCBI)