Amino-PEG14-alcohol
cas: 34214-89-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Amino-PEG14-alcohol (CAS 34214-89-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 25 mg. Oferty producentów: TargetMol, MedChemExpress.
| producent | TargetMol |
|---|---|
| nr katalogowy | T17413-1mg |
| cas | 34214-89-6 |
| opakowanie | 1mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| TargetMol | 1mg | 379,44 Pln | |
| TargetMol | 5mg | 591,86 Pln | |
| TargetMol | 10mg | 778,01 Pln | |
| TargetMol | 25mg | 1163,16 Pln | |
| TargetMol | 50mg | 1620,98 Pln | |
| TargetMol | 100mg | 2231,97 Pln | |
| TargetMol | 200mg | 3108,48 Pln | |
| MedChemExpress | 25 mg | 2507,02 Pln | |
| MedChemExpress | 50 mg | 3937,37 Pln |
właściwości
| czystość | No data |
|---|---|
| czas dostawy | ok. 15 dni |
2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol (CAS 34214-89-6) to związek chemiczny o wzorze sumarycznym C28H59NO14 i masie molowej 633.8 g/mol. Nazwa systematyczna IUPAC: 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol. InChIKey: VDYXUUXKLNRRGU-UHFFFAOYSA-N.
| Wzór sumaryczny | C28H59NO14 |
|---|---|
| Masa molowa | 633.8 g/mol |
| Nazwa IUPAC | 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
| InChIKey | VDYXUUXKLNRRGU-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO)N |
Dane obliczone przez PubChem (NCBI)