cas: 2170987-96-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Amino-PEG24-Boc 95% (CAS 2170987-96-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g. Oferty producentów: Ambeed.
| producent | Ambeed |
|---|---|
| nr katalogowy | A1156978-100mg |
| cas | 2170987-96-7 |
| opakowanie | 100mg |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 100mg | 553,94 Pln | |
| Ambeed | 250mg | 893,25 Pln | |
| Ambeed | 1g | 2289,44 Pln |
| czystość | 95% |
|---|---|
| czas dostawy | 2-3 tygodnie |
| nr katalogowy ambeed | A1156978 |
Tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 2170987-96-7) to związek chemiczny o wzorze sumarycznym C55H111NO26 i masie molowej 1202.5 g/mol. Nazwa systematyczna IUPAC: tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: LWHDVGRAEHWWFV-UHFFFAOYSA-N.
| Wzór sumaryczny | C55H111NO26 |
|---|---|
| Masa molowa | 1202.5 g/mol |
| Nazwa IUPAC | tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | LWHDVGRAEHWWFV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN |
Dane obliczone przez PubChem (NCBI)