cas: 756526-04-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Amino-PEG8-Acid, 95%, 95% (CAS 756526-04-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10g, 50g, 100g, 250g, 500g, 100mg, 250mg, 1g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11G7V0-10g |
| cas | 756526-04-2 |
| opakowanie | 10g |
| dostępność | 1000g |
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 10g | 1302,80 Pln | |
| Chemat | 50g | 3645,20 Pln | |
| Chemat | 100g | 6266,00 Pln | |
| Chemat | 250g | 11128,40 Pln | |
| Chemat | 500g | 20798,40 Pln | |
| Chemat | 100mg | 131,60 Pln | |
| Chemat | 250mg | 165,20 Pln | |
| Chemat | 1g | 371,60 Pln | |
| Chemat | 5g | 890,00 Pln | |
| Chemat | 25g | 2128,40 Pln |
| czystość | 95% |
|---|---|
| czas dostawy | 3 tygodnie |
3-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 756526-04-2) to związek chemiczny o wzorze sumarycznym C19H39NO10 i masie molowej 441.5 g/mol. Nazwa systematyczna IUPAC: 3-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: YLKOHZCQTVYVDB-UHFFFAOYSA-N.
| Wzór sumaryczny | C19H39NO10 |
|---|---|
| Masa molowa | 441.5 g/mol |
| Nazwa IUPAC | 3-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | YLKOHZCQTVYVDB-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCN)C(=O)O |
Dane obliczone przez PubChem (NCBI)