cas: 474082-35-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Amino-PEG9-amine, 97.0% (CAS 474082-35-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 500 mg, 250 mg, 100 mg, 1 g, 5 g. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-140210-500 mg |
| cas | 474082-35-4 |
| opakowanie | 500 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 500 mg | 784,09 Pln | |
| MedChemExpress | 250 mg | 472,94 Pln | |
| MedChemExpress | 100 mg | 342,91 Pln | |
| MedChemExpress | 1 g | 960,56 Pln | |
| MedChemExpress | 5 g | 2781,01 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 97.0% |
2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine (CAS 474082-35-4) to związek chemiczny o wzorze sumarycznym C20H44N2O9 i masie molowej 456.6 g/mol. Nazwa systematyczna IUPAC: 2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine. InChIKey: YWYRXJJAEDMZGY-UHFFFAOYSA-N.
| Wzór sumaryczny | C20H44N2O9 |
|---|---|
| Masa molowa | 456.6 g/mol |
| Nazwa IUPAC | 2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine |
| InChIKey | YWYRXJJAEDMZGY-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCN)N |
Dane obliczone przez PubChem (NCBI)