cas: 1146699-66-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Avagacestat, 99.92% (CAS 1146699-66-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5 mg, 1 mg, 25 mg, 10 mg, 50 mg, 10mM/1mL, 100 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-50845-5 mg |
| cas | 1146699-66-2 |
| opakowanie | 5 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 5 mg | 849,11 Pln | |
| MedChemExpress | 1 mg | 463,66 Pln | |
| MedChemExpress | 25 mg | 2307,32 Pln | |
| MedChemExpress | 10 mg | 1285,64 Pln | |
| MedChemExpress | 50 mg | 3296,50 Pln | |
| MedChemExpress | 10mM/1mL | 955,92 Pln | |
| MedChemExpress | 100 mg | 4726,85 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.92% |
(2R)-2-[(4-chlorophenyl)sulfonyl-[[2-fluoro-4-(1,2,4-oxadiazol-3-yl)phenyl]methyl]amino]-5,5,5-trifluoropentanamide (CAS 1146699-66-2) to związek chemiczny o wzorze sumarycznym C20H17ClF4N4O4S i masie molowej 520.9 g/mol. Nazwa systematyczna IUPAC: (2R)-2-[(4-chlorophenyl)sulfonyl-[[2-fluoro-4-(1,2,4-oxadiazol-3-yl)phenyl]methyl]amino]-5,5,5-trifluoropentanamide. InChIKey: XEAOPVUAMONVLA-QGZVFWFLSA-N.
| Wzór sumaryczny | C20H17ClF4N4O4S |
|---|---|
| Masa molowa | 520.9 g/mol |
| Nazwa IUPAC | (2R)-2-[(4-chlorophenyl)sulfonyl-[[2-fluoro-4-(1,2,4-oxadiazol-3-yl)phenyl]methyl]amino]-5,5,5-trifluoropentanamide |
| InChIKey | XEAOPVUAMONVLA-QGZVFWFLSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)N(CC2=C(C=C(C=C2)C3=NOC=N3)F)[C@H](CCC(F)(F)F)C(=O)N)Cl |
Dane obliczone przez PubChem (NCBI)