Avenanthramide C, 99.40% ,, 99.40% ,
cas: 116764-15-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Avenanthramide C, 99.40% ,, 99.40% , (CAS 116764-15-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch110L2M-1mg |
| cas | 116764-15-9 |
| opakowanie | 1mg |
| dostępność | 0.2g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 1mg | 405,20 Pln | |
| Chemat | 5mg | 875,60 Pln | |
| Chemat | 10mg | 1360,40 Pln | |
| Chemat | 25mg | 2258,00 Pln | |
| Chemat | 50mg | 3342,80 Pln | |
| Chemat | 100mg | 4749,20 Pln | |
| Chemat | 200mg | 6578,00 Pln |
właściwości
| czystość | 99.40% , |
|---|---|
| czas dostawy | 3 tygodnie |
2-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]-5-hydroxybenzoic acid (CAS 116764-15-9) to związek chemiczny o wzorze sumarycznym C16H13NO6 i masie molowej 315.28 g/mol. Nazwa systematyczna IUPAC: 2-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]-5-hydroxybenzoic acid. InChIKey: IDUUXROOZBOOPH-QHHAFSJGSA-N.
| Wzór sumaryczny | C16H13NO6 |
|---|---|
| Masa molowa | 315.28 g/mol |
| Nazwa IUPAC | 2-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]-5-hydroxybenzoic acid |
| InChIKey | IDUUXROOZBOOPH-QHHAFSJGSA-N |
| SMILES | C1=CC(=C(C=C1/C=C/C(=O)NC2=C(C=C(C=C2)O)C(=O)O)O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Avenanthramide C, Avenanthramide BC, 2-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]-5-hydroxybenzoic acid, 2-[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enamido]-5-hydroxybenzoic acid, 2-(((E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl)amino)-5-hydroxybenzoic acid, 2-((2E)-3-(3,4-dihydroxyphenyl)prop-2-enamido)-5-hydroxybenzoic acid, Avenanthramide 2C, Avenanthramide, (E)-2-(3-(3,4-Dihydroxyphenyl)acrylamido)-5-hydroxybenzoic acid, N-(3',4'-dihydroxycinnamoyl)-5-hydroxyanthranilic acid