Azido-PEG2-CH2COOH, 99.03%
cas: 882518-90-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Azido-PEG2-CH2COOH, 99.03% (CAS 882518-90-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250 mg, 10 g, 100 mg, 1 g, 5 g. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-108368-250 mg |
| cas | 882518-90-3 |
| opakowanie | 250 mg |
| dostępność | In stock |
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 250 mg | 407,93 Pln | |
| MedChemExpress | 10 g | 3742,32 Pln | |
| MedChemExpress | 100 mg | 361,49 Pln | |
| MedChemExpress | 1 g | 695,86 Pln | |
| MedChemExpress | 5 g | 2135,50 Pln |
właściwości
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 99.03% |
2-[2-(2-azidoethoxy)ethoxy]acetic acid (CAS 882518-90-3) to związek chemiczny o wzorze sumarycznym C6H11N3O4 i masie molowej 189.17 g/mol. Nazwa systematyczna IUPAC: 2-[2-(2-azidoethoxy)ethoxy]acetic acid. InChIKey: OCIIYNXOTJRSHW-UHFFFAOYSA-N.
| Wzór sumaryczny | C6H11N3O4 |
|---|---|
| Masa molowa | 189.17 g/mol |
| Nazwa IUPAC | 2-[2-(2-azidoethoxy)ethoxy]acetic acid |
| InChIKey | OCIIYNXOTJRSHW-UHFFFAOYSA-N |
| SMILES | C(COCCOCC(=O)O)N=[N+]=[N-] |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Azido-PEG2-CH2COOH, Azido-PEG2-CH2CO2H, 2-[2-(2-Azidoethoxy)ethoxy]acetic acid, 2-(2-(2-azidoethoxy)ethoxy)acetic acid, Acetic acid, [2-(2-azidoethoxy)ethoxy]-, Azido-PEG2-acetic Acid, 3,6-Dioxa-8-azidooctanoic acid, N-(2-(2-(2-azidoethoxy)ethoxy))acetic acid, Azide-PEG2-CH2COOH, (2-(2-Azidoethoxy)ethoxy)acetic acid