cas: 864681-04-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Azido-PEG4-CH2-Boc, 97.0% (CAS 864681-04-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 25 g, 500 mg, 10 g, 100 mg, 5 g, 250 mg, 1 g. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-42618-25 g |
| cas | 864681-04-9 |
| opakowanie | 25 g |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 25 g | 6505,50 Pln | |
| MedChemExpress | 500 mg | 1053,44 Pln | |
| MedChemExpress | 10 g | 3161,82 Pln | |
| MedChemExpress | 100 mg | 435,79 Pln | |
| MedChemExpress | 5 g | 1917,23 Pln | |
| MedChemExpress | 250 mg | 746,94 Pln | |
| MedChemExpress | 1 g | 1522,49 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 97.0% |
Tert-butyl 2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]acetate (CAS 864681-04-9) to związek chemiczny o wzorze sumarycznym C14H27N3O6 i masie molowej 333.38 g/mol. Nazwa systematyczna IUPAC: tert-butyl 2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]acetate. InChIKey: SIOLYQZSIFQODW-UHFFFAOYSA-N.
| Wzór sumaryczny | C14H27N3O6 |
|---|---|
| Masa molowa | 333.38 g/mol |
| Nazwa IUPAC | tert-butyl 2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]acetate |
| InChIKey | SIOLYQZSIFQODW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCCOCCN=[N+]=[N-] |
Dane obliczone przez PubChem (NCBI)