B-[4-[(Trifluoromethyl)thio]phenyl]boronic acid, 95+%, 95+%
cas: 947533-15-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
B-[4-[(Trifluoromethyl)thio]phenyl]boronic acid, 95+%, 95+% (CAS 947533-15-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 50mg, 100mg, 250mg, 1g, 5g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch117SC4-50mg |
| cas | 947533-15-5 |
| opakowanie | 50mg |
| dostępność | 10g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 50mg | 146,00 Pln | |
| Chemat | 100mg | 203,60 Pln | |
| Chemat | 250mg | 304,40 Pln | |
| Chemat | 1g | 712,40 Pln | |
| Chemat | 5g | 2334,80 Pln |
właściwości
| czystość | 95+% |
|---|---|
| czas dostawy | 3 tygodnie |
[4-(trifluoromethylsulfanyl)phenyl]boronic acid (CAS 947533-15-5) to związek chemiczny o wzorze sumarycznym C7H6BF3O2S i masie molowej 222.00 g/mol. Nazwa systematyczna IUPAC: [4-(trifluoromethylsulfanyl)phenyl]boronic acid. InChIKey: LCTCJAHRVYNYTQ-UHFFFAOYSA-N.
| Wzór sumaryczny | C7H6BF3O2S |
|---|---|
| Masa molowa | 222.00 g/mol |
| Nazwa IUPAC | [4-(trifluoromethylsulfanyl)phenyl]boronic acid |
| InChIKey | LCTCJAHRVYNYTQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)SC(F)(F)F)(O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
{4-[(Trifluoromethyl)sulfanyl]phenyl}boronic acid, (4-((trifluoromethyl)sulfanyl)phenyl)boronic acid, (4-((Trifluoromethyl)thio)phenyl)boronic acid, [4-(trifluoromethylsulfanyl)phenyl]boronic acid, 4-(Trifluoromethylthio)phenylboronic acid, B-[4-[(Trifluoromethyl)thio]phenyl]boronic acid, 4-SCF3-phenyl boronic acid, Boronic acid, B-[4-[(trifluoromethyl)thio]phenyl]-, 4-[(Trifluoromethyl)thio]phenylboronic Acid, (4-((Trifluoromethyl)thio)phenyl)boronicacid