BML-111 97%
cas: 78606-80-1 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
BML-111 97% (CAS 78606-80-1) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10mg, 25mg, 50mg, 100mg, 250mg. Oferty producentów: Ambeed.
| producent | Ambeed |
|---|---|
| nr katalogowy | A1208573-10mg |
| cas | 78606-80-1 |
| opakowanie | 10mg |
Dokumenty:
Karta charakterystyki (MSDS)
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 10mg | 670,75 Pln | |
| Ambeed | 25mg | 1204,75 Pln | |
| Ambeed | 50mg | 2000,19 Pln | |
| Ambeed | 100mg | 3346,31 Pln | |
| Ambeed | 250mg | 5638,06 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 2-3 tygodnie |
| nr katalogowy ambeed | A1208573 |
Methyl (5S,6R)-5,6,7-trihydroxyheptanoate (CAS 78606-80-1) to związek chemiczny o wzorze sumarycznym C8H16O5 i masie molowej 192.21 g/mol. Nazwa systematyczna IUPAC: methyl (5S,6R)-5,6,7-trihydroxyheptanoate. InChIKey: RNMFWAFZUNVQOR-NKWVEPMBSA-N.
| Wzór sumaryczny | C8H16O5 |
|---|---|
| Masa molowa | 192.21 g/mol |
| Nazwa IUPAC | methyl (5S,6R)-5,6,7-trihydroxyheptanoate |
| InChIKey | RNMFWAFZUNVQOR-NKWVEPMBSA-N |
| SMILES | COC(=O)CCC[C@@H]([C@@H](CO)O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
(5S,6R)-Methyl 5,6,7-trihydroxyheptanoate, Methyl (5S,6R)-5,6,7-trihydroxyheptanoate, 5(S),6(R)-7-trihydroxymethyl Heptanoate, 5(s),6(r),7-trihydroxyheptanoic acid methyl ester, 5(S),6(R)-trihydroxy-7-heptanoic acid, methyl ester, orb1704725, 6(R)-7-trihydroxymethyl Heptanoate, 1,3-Benzodioxole-9-sulfonylchloride, Heptanoic acid, 5,6,7-trihydroxy-, methyl ester, (5S,6R)-, 5(S),6(R),7-Trihydroxyheptanoic acid methyl ester, >=98% (HPLC)