cas: 684238-37-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
BMS-986187, 99.66% (CAS 684238-37-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10mM/1mL, 100 mg, 50 mg, 5 mg, 25 mg, 10 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-120613-10mM/1mL |
| cas | 684238-37-7 |
| opakowanie | 10mM/1mL |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 589,04 Pln | |
| MedChemExpress | 100 mg | 3236,12 Pln | |
| MedChemExpress | 50 mg | 2135,50 Pln | |
| MedChemExpress | 5 mg | 575,11 Pln | |
| MedChemExpress | 25 mg | 1513,20 Pln | |
| MedChemExpress | 10 mg | 839,82 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.66% |
3,3,6,6-tetramethyl-9-[4-[(2-methylphenyl)methoxy]phenyl]-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione (CAS 684238-37-7) to związek chemiczny o wzorze sumarycznym C31H34O4 i masie molowej 470.6 g/mol. Nazwa systematyczna IUPAC: 3,3,6,6-tetramethyl-9-[4-[(2-methylphenyl)methoxy]phenyl]-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione. InChIKey: UEKIYVKPQNKSDI-UHFFFAOYSA-N.
| Wzór sumaryczny | C31H34O4 |
|---|---|
| Masa molowa | 470.6 g/mol |
| Nazwa IUPAC | 3,3,6,6-tetramethyl-9-[4-[(2-methylphenyl)methoxy]phenyl]-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
| InChIKey | UEKIYVKPQNKSDI-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1COC2=CC=C(C=C2)C3C4=C(CC(CC4=O)(C)C)OC5=C3C(=O)CC(C5)(C)C |
Dane obliczone przez PubChem (NCBI)