cas: 1835667-63-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Befotertinib, 99%, 99% (CAS 1835667-63-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch135BDW-1mg |
| cas | 1835667-63-4 |
| opakowanie | 1mg |
| dostępność | 0.75g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 1mg | 438,80 Pln | |
| Chemat | 5mg | 515,60 Pln | |
| Chemat | 10mg | 832,40 Pln | |
| Chemat | 25mg | 1370,00 Pln | |
| Chemat | 50mg | 2282,00 Pln | |
| Chemat | 100mg | 3837,20 Pln | |
| Chemat | 250mg | 7614,80 Pln |
| czystość | 99% |
|---|---|
| czas dostawy | 3 tygodnie |
N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methoxy-5-[[4-[1-(2,2,2-trifluoroethyl)indol-3-yl]pyrimidin-2-yl]amino]phenyl]prop-2-enamide (CAS 1835667-63-4) to związek chemiczny o wzorze sumarycznym C29H32F3N7O2 i masie molowej 567.6 g/mol. Nazwa systematyczna IUPAC: N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methoxy-5-[[4-[1-(2,2,2-trifluoroethyl)indol-3-yl]pyrimidin-2-yl]amino]phenyl]prop-2-enamide. InChIKey: USOCZVZOXKTJTI-UHFFFAOYSA-N.
| Wzór sumaryczny | C29H32F3N7O2 |
|---|---|
| Masa molowa | 567.6 g/mol |
| Nazwa IUPAC | N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methoxy-5-[[4-[1-(2,2,2-trifluoroethyl)indol-3-yl]pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
| InChIKey | USOCZVZOXKTJTI-UHFFFAOYSA-N |
| SMILES | CN(C)CCN(C)C1=CC(=C(C=C1NC(=O)C=C)NC2=NC=CC(=N2)C3=CN(C4=CC=CC=C43)CC(F)(F)F)OC |
Dane obliczone przez PubChem (NCBI)