cas: 86770-77-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Benzyl-PEG5-amine, 98.0% (CAS 86770-77-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1 g, 10 mg, 250 mg, 25 mg, 5 mg, 100 mg, 50 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-140743-1 g |
| cas | 86770-77-6 |
| opakowanie | 1 g |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 1 g | 5892,49 Pln | |
| MedChemExpress | 10 mg | 412,57 Pln | |
| MedChemExpress | 250 mg | 2260,88 Pln | |
| MedChemExpress | 25 mg | 644,77 Pln | |
| MedChemExpress | 5 mg | 315,05 Pln | |
| MedChemExpress | 100 mg | 1378,52 Pln | |
| MedChemExpress | 50 mg | 932,70 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 98.0% |
2-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]ethanamine (CAS 86770-77-6) to związek chemiczny o wzorze sumarycznym C17H29NO5 i masie molowej 327.4 g/mol. Nazwa systematyczna IUPAC: 2-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]ethanamine. InChIKey: OOHIPYDPAMVVIQ-UHFFFAOYSA-N.
| Wzór sumaryczny | C17H29NO5 |
|---|---|
| Masa molowa | 327.4 g/mol |
| Nazwa IUPAC | 2-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]ethanamine |
| InChIKey | OOHIPYDPAMVVIQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COCCOCCOCCOCCOCCN |
Dane obliczone przez PubChem (NCBI)