Bis(2,4-dimethylphenyl)amine 97%
cas: 19616-28-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Bis(2,4-dimethylphenyl)amine 97% (CAS 19616-28-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 10g, 25g. Oferty producentów: Ambeed.
| producent | Ambeed |
|---|---|
| nr katalogowy | A161501-250mg |
| cas | 19616-28-5 |
| opakowanie | 250mg |
Dokumenty:
Karta charakterystyki (MSDS)
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 192,38 Pln | |
| Ambeed | 1g | 292,50 Pln | |
| Ambeed | 5g | 704,12 Pln | |
| Ambeed | 10g | 1154,69 Pln | |
| Ambeed | 25g | 2167,06 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 1-2 tygodnie |
| nr katalogowy ambeed | A161501 |
N-(2,4-dimethylphenyl)-2,4-dimethylaniline (CAS 19616-28-5) to związek chemiczny o wzorze sumarycznym C16H19N i masie molowej 225.33 g/mol. Nazwa systematyczna IUPAC: N-(2,4-dimethylphenyl)-2,4-dimethylaniline. InChIKey: MAINCNYZMOMWRA-UHFFFAOYSA-N.
| Wzór sumaryczny | C16H19N |
|---|---|
| Masa molowa | 225.33 g/mol |
| Nazwa IUPAC | N-(2,4-dimethylphenyl)-2,4-dimethylaniline |
| InChIKey | MAINCNYZMOMWRA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC2=C(C=C(C=C2)C)C)C |
Dane obliczone przez PubChem (NCBI)
Synonimy:
bis(2,4-dimethylphenyl)amine, N-(2,4-Dimethylphenyl)-2,4-dimethylaniline, Di-2,4-xylylamine, Benzenamine, N-(2,4-dimethylphenyl)-2,4-dimethyl-, N-(2,4-dimethylphenyl)-2,4-dimethyl-aniline, 2,2'4,4'-tetramethyldiphenylamine, 2,4,2',4'- tetramethyl diphenylamine, N-(2,4-Dimethylphenyl)-2,4-dimethylbenzemine