Bis(4-bromophenyl)methane, 98%
cas: 1941-86-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Bis(4-bromophenyl)methane, 98% (CAS 1941-86-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1g, 5g, 25g, 100mg, 250mg. Oferty producentów: Ambeed, Chemat, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A1687414-1g |
| cas | 1941-86-2 |
| opakowanie | 1g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 1g | 620,69 Pln | |
| Ambeed | 5g | 2072,50 Pln | |
| Ambeed | 25g | 6733,88 Pln | |
| Chemat | 100mg | 136,40 Pln | |
| Chemat | 250mg | 198,80 Pln | |
| Chemat | 1g | 429,20 Pln | |
| Chemat | 5g | 1830,80 Pln | |
| Chemat | 25g | 6251,60 Pln | |
| BLDpharm | 1g | 664,24 Pln | |
| BLDpharm | 5g | 2174,81 Pln | |
| BLDpharm | 25g | 7250,80 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 2-3 tygodnie |
1-bromo-4-[(4-bromophenyl)methyl]benzene (CAS 1941-86-2) to związek chemiczny o wzorze sumarycznym C13H10Br2 i masie molowej 326.03 g/mol. Nazwa systematyczna IUPAC: 1-bromo-4-[(4-bromophenyl)methyl]benzene. InChIKey: IYOYOEKCRDEIPQ-UHFFFAOYSA-N.
| Wzór sumaryczny | C13H10Br2 |
|---|---|
| Masa molowa | 326.03 g/mol |
| Nazwa IUPAC | 1-bromo-4-[(4-bromophenyl)methyl]benzene |
| InChIKey | IYOYOEKCRDEIPQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=CC=C(C=C2)Br)Br |
Dane obliczone przez PubChem (NCBI)
Synonimy:
4,4'-Dibromodiphenylmethane, Benzene, 1,1'-methylenebis(4-bromo-, Benzene, 1,1'-methylenebis[4-bromo-, Bis(4-bromophenyl)methane, Methane, bis(p-bromophenyl)-, 1,1'-Methylenebis[4-bromobenzene], 1,1'-Methylenebis(4-bromobenzene), 1-bromo-4-[(4-bromophenyl)methyl]benzene, Diphenylmethane, 4,4'-dibromo-, 1,1'-Methylenebis[4-bromobenzene