cas: 2221948-93-0 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Bis-PEG17-NHS ester (CAS 2221948-93-0) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg. Oferty producentów: TargetMol.
| producent | TargetMol |
|---|---|
| nr katalogowy | T17622-1mg |
| cas | 2221948-93-0 |
| opakowanie | 1mg |
| producent | opakowanie | cena | |
|---|---|---|---|
| TargetMol | 1mg | 532,05 Pln | |
| TargetMol | 5mg | 983,72 Pln | |
| TargetMol | 10mg | 1348,75 Pln | |
| TargetMol | 25mg | 2072,65 Pln | |
| TargetMol | 50mg | 3095,62 Pln | |
| TargetMol | 100mg | 4417,10 Pln | |
| TargetMol | 500mg | 9218,35 Pln |
| czystość | No data |
|---|---|
| czas dostawy | ok. 33 dni |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 2221948-93-0) to związek chemiczny o wzorze sumarycznym C46H80N2O25 i masie molowej 1061.1 g/mol. Nazwa systematyczna IUPAC: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: NKGAYEIPIYDEJM-UHFFFAOYSA-N.
| Wzór sumaryczny | C46H80N2O25 |
|---|---|
| Masa molowa | 1061.1 g/mol |
| Nazwa IUPAC | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | NKGAYEIPIYDEJM-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)ON2C(=O)CCC2=O |
Dane obliczone przez PubChem (NCBI)