cas: 113963-68-1 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Bisindolylmaleimide V, 97.75% (CAS 113963-68-1) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 25 mg, 1 g, 50 mg, 250 mg, 10 mg, 500 mg, 5 mg, 100 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-112400-25 mg |
| cas | 113963-68-1 |
| opakowanie | 25 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 25 mg | 2400,20 Pln | |
| MedChemExpress | 1 g | 10531,85 Pln | |
| MedChemExpress | 50 mg | 3082,87 Pln | |
| MedChemExpress | 250 mg | 6287,23 Pln | |
| MedChemExpress | 10 mg | 1462,12 Pln | |
| MedChemExpress | 500 mg | 8130,90 Pln | |
| MedChemExpress | 5 mg | 1081,31 Pln | |
| MedChemExpress | 100 mg | 3979,16 Pln | |
| MedChemExpress | 5 g | 20270,32 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 97.75% |
3,4-bis(1H-indol-3-yl)-1-methylpyrrole-2,5-dione (CAS 113963-68-1) to związek chemiczny o wzorze sumarycznym C21H15N3O2 i masie molowej 341.4 g/mol. Nazwa systematyczna IUPAC: 3,4-bis(1H-indol-3-yl)-1-methylpyrrole-2,5-dione. InChIKey: SWAWYMIKGOHZMR-UHFFFAOYSA-N.
| Wzór sumaryczny | C21H15N3O2 |
|---|---|
| Masa molowa | 341.4 g/mol |
| Nazwa IUPAC | 3,4-bis(1H-indol-3-yl)-1-methylpyrrole-2,5-dione |
| InChIKey | SWAWYMIKGOHZMR-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(=C(C1=O)C2=CNC3=CC=CC=C32)C4=CNC5=CC=CC=C54 |
Dane obliczone przez PubChem (NCBI)