cas: 959237-16-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Boc-bipiperidine-NH2, 97.0% (CAS 959237-16-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 500 mg, 1 g, 10 g, 5 g, 250 mg, 100 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-W043245-500 mg |
| cas | 959237-16-2 |
| opakowanie | 500 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 500 mg | 695,86 Pln | |
| MedChemExpress | 1 g | 1039,51 Pln | |
| MedChemExpress | 10 g | 5474,53 Pln | |
| MedChemExpress | 5 g | 3212,90 Pln | |
| MedChemExpress | 250 mg | 454,37 Pln | |
| MedChemExpress | 100 mg | 287,18 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 97.0% |
Tert-butyl 4-(4-aminopiperidin-1-yl)piperidine-1-carboxylate (CAS 959237-16-2) to związek chemiczny o wzorze sumarycznym C15H29N3O2 i masie molowej 283.41 g/mol. Nazwa systematyczna IUPAC: tert-butyl 4-(4-aminopiperidin-1-yl)piperidine-1-carboxylate. InChIKey: AHAQZBVUGZUUMB-UHFFFAOYSA-N.
| Wzór sumaryczny | C15H29N3O2 |
|---|---|
| Masa molowa | 283.41 g/mol |
| Nazwa IUPAC | tert-butyl 4-(4-aminopiperidin-1-yl)piperidine-1-carboxylate |
| InChIKey | AHAQZBVUGZUUMB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)N2CCC(CC2)N |
Dane obliczone przez PubChem (NCBI)