Borane, fluorobis(2,4,6-trimethylphenyl)-, 95%, 95%
cas: 436-59-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Borane, fluorobis(2,4,6-trimethylphenyl)-, 95%, 95% (CAS 436-59-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 10g, 15g, 25g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch114PKE-100mg |
| cas | 436-59-9 |
| opakowanie | 100mg |
| dostępność | 500g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 126,80 Pln | |
| Chemat | 250mg | 170,00 Pln | |
| Chemat | 1g | 203,60 Pln | |
| Chemat | 5g | 688,40 Pln | |
| Chemat | 10g | 1293,20 Pln | |
| Chemat | 15g | 1850,00 Pln | |
| Chemat | 25g | 2992,40 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 3 tygodnie |
Fluoro-bis(2,4,6-trimethylphenyl)borane (CAS 436-59-9) to związek chemiczny o wzorze sumarycznym C18H22BF i masie molowej 268.2 g/mol. Nazwa systematyczna IUPAC: fluoro-bis(2,4,6-trimethylphenyl)borane. InChIKey: WZWGERGANZMXOM-UHFFFAOYSA-N.
| Wzór sumaryczny | C18H22BF |
|---|---|
| Masa molowa | 268.2 g/mol |
| Nazwa IUPAC | fluoro-bis(2,4,6-trimethylphenyl)borane |
| InChIKey | WZWGERGANZMXOM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1C)C)C)(C2=C(C=C(C=C2C)C)C)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Dimesitylboron fluoride, Dimesitylfluoroborane, fluorodimesitylborane, Fluoro-bis(2,4,6-trimethylphenyl)borane, fluorobis(2,4,6-trimethylphenyl)borane, Borane, fluorobis(2,4,6-trimethylphenyl)-, dimesityifluoroborane, dimesityl boron fluoride, fluoro[bis(2,4,6-trimethylphenyl)]borane, Bis-(2,4,6-trimethyl-phenyl)-fluoroborane