CAY10397
cas: 78028-01-0 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
CAY10397 (CAS 78028-01-0) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 5mg, 10mg, 25mg, 1 mg, 5 mg. Oferty producentów: TargetMol, GLPBio, MedChemExpress.
| producent | TargetMol |
|---|---|
| nr katalogowy | T26956-1mg |
| cas | 78028-01-0 |
| opakowanie | 1mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| TargetMol | 1mg | 1129,62 Pln | |
| TargetMol | 5mg | 4191,26 Pln | |
| TargetMol | 10mg | 7265,76 Pln | |
| TargetMol | 25mg | 15593,74 Pln | |
| GLPBio | 1mg | 788,94 Pln | |
| GLPBio | 10mg | 3377,26 Pln | |
| GLPBio | 25mg | 6878,27 Pln | |
| GLPBio | 5mg | 2085,44 Pln | |
| MedChemExpress | 1 mg | 742,30 Pln | |
| MedChemExpress | 5 mg | 2790,30 Pln |
właściwości
| czystość | No data |
|---|---|
| czas dostawy | na zapytanie |
2-[5-[(4-ethoxycarbonylphenyl)diazenyl]-2-hydroxyphenyl]acetic acid (CAS 78028-01-0) to związek chemiczny o wzorze sumarycznym C17H16N2O5 i masie molowej 328.32 g/mol. Nazwa systematyczna IUPAC: 2-[5-[(4-ethoxycarbonylphenyl)diazenyl]-2-hydroxyphenyl]acetic acid. InChIKey: YYBSDOZYJSGLTH-UHFFFAOYSA-N.
| Wzór sumaryczny | C17H16N2O5 |
|---|---|
| Masa molowa | 328.32 g/mol |
| Nazwa IUPAC | 2-[5-[(4-ethoxycarbonylphenyl)diazenyl]-2-hydroxyphenyl]acetic acid |
| InChIKey | YYBSDOZYJSGLTH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)N=NC2=CC(=C(C=C2)O)CC(=O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
5-[2-[4-(Ethoxycarbonyl)phenyl]diazenyl]-2-hydroxybenzeneacetic acid, 5-(2-(4-(Ethoxycarbonyl)phenyl)diazenyl)-2-hydroxybenzeneacetic acid, cay10397, 2-[5-[(4-ethoxycarbonylphenyl)diazenyl]-2-hydroxyphenyl]acetic acid, 2-(5-((4-(Ethoxycarbonyl)phenyl)diazenyl)-2-hydroxyphenyl)acetic acid, orb1700913, 5-Benzolazo-2-oxy-hydrozimtsaeure, (5-{[4-(Ethoxycarbonyl)phenyl]diazenyl}-2-hydroxyphenyl)acetic acid, (5-{(E)-[4-(ethoxycarbonyl)phenyl]diazenyl}-2-hydroxyphenyl)acetic acid