CAY10583
cas: 862891-27-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
CAY10583 (CAS 862891-27-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5mg, 10mg, 25mg, 50mg. Oferty producentów: TargetMol, GLPBio, Chemat.
| producent | TargetMol |
|---|---|
| nr katalogowy | T26958-5mg |
| cas | 862891-27-8 |
| opakowanie | 5mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| TargetMol | 5mg | 1163,16 Pln | |
| TargetMol | 10mg | 1966,44 Pln | |
| TargetMol | 25mg | 4363,99 Pln | |
| TargetMol | 50mg | 7578,24 Pln | |
| GLPBio | 10mg | 1149,34 Pln | |
| GLPBio | 25mg | 2150,97 Pln | |
| GLPBio | 5mg | 798,30 Pln | |
| GLPBio | 50mg | 3494,27 Pln | |
| Chemat | 5mg | 904,40 Pln | |
| Chemat | 25mg | 3170,00 Pln |
właściwości
| czystość | No data |
|---|---|
| czas dostawy | na zapytanie |
2-[4-[(N-pentanoylanilino)methyl]phenyl]benzoic acid (CAS 862891-27-8) to związek chemiczny o wzorze sumarycznym C25H25NO3 i masie molowej 387.5 g/mol. Nazwa systematyczna IUPAC: 2-[4-[(N-pentanoylanilino)methyl]phenyl]benzoic acid. InChIKey: IUJTVDNJFPZYBL-UHFFFAOYSA-N.
| Wzór sumaryczny | C25H25NO3 |
|---|---|
| Masa molowa | 387.5 g/mol |
| Nazwa IUPAC | 2-[4-[(N-pentanoylanilino)methyl]phenyl]benzoic acid |
| InChIKey | IUJTVDNJFPZYBL-UHFFFAOYSA-N |
| SMILES | CCCCC(=O)N(CC1=CC=C(C=C1)C2=CC=CC=C2C(=O)O)C3=CC=CC=C3 |
Dane obliczone przez PubChem (NCBI)
Synonimy:
2-{4-[(N-phenylpentanamido)methyl]phenyl}benzoic acid, 2-(4-((N-phenylpentanamido)methyl)phenyl)benzoic acid, 2-[4-[(N-pentanoylanilino)methyl]phenyl]benzoic acid, 4'-[[(1-oxopentyl)phenylamino]methyl]-[1,1'-biphenyl]-2-carboxylic acid, orb1700911, IUJTVDNJFPZYBL-UHFFFAOYSA-N, 4'-[(N-phenylpentanamido)methyl]biphenyl-2-carboxylic acid, 4'-[(N-Phenylpentanamido)methyl][1,1'-biphenyl]-2-carboxylic acid, 4'-((N-Phenylpentanamido)methyl)-[1,1'-biphenyl]-2-carboxylic acid, 4'-{[Pentanoyl(phenyl)amino]methyl}[1,1'-biphenyl]-2-carboxylic acid