CBR-5884 99%
cas: 681159-27-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
CBR-5884 99% (CAS 681159-27-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Oferty producentów: Ambeed.
| producent | Ambeed |
|---|---|
| nr katalogowy | A780427-1mg |
| cas | 681159-27-3 |
| opakowanie | 1mg |
Dokumenty:
Karta charakterystyki (MSDS)
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 1mg | 236,88 Pln | |
| Ambeed | 5mg | 275,81 Pln | |
| Ambeed | 10mg | 320,31 Pln | |
| Ambeed | 25mg | 392,62 Pln | |
| Ambeed | 50mg | 481,62 Pln | |
| Ambeed | 100mg | 709,69 Pln | |
| Ambeed | 250mg | 1282,62 Pln |
właściwości
| czystość | 99% |
|---|---|
| czas dostawy | 1-2 tygodnie |
| nr katalogowy ambeed | A780427 |
Ethyl 5-(furan-2-carbonylamino)-3-methyl-4-thiocyanatothiophene-2-carboxylate (CAS 681159-27-3) to związek chemiczny o wzorze sumarycznym C14H12N2O4S2 i masie molowej 336.4 g/mol. Nazwa systematyczna IUPAC: ethyl 5-(furan-2-carbonylamino)-3-methyl-4-thiocyanatothiophene-2-carboxylate. InChIKey: QBVIRPJBDIZKBC-UHFFFAOYSA-N.
| Wzór sumaryczny | C14H12N2O4S2 |
|---|---|
| Masa molowa | 336.4 g/mol |
| Nazwa IUPAC | ethyl 5-(furan-2-carbonylamino)-3-methyl-4-thiocyanatothiophene-2-carboxylate |
| InChIKey | QBVIRPJBDIZKBC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(S1)NC(=O)C2=CC=CO2)SC#N)C |
Dane obliczone przez PubChem (NCBI)
Synonimy:
ethyl 5-(furan-2-carbonylamino)-3-methyl-4-thiocyanatothiophene-2-carboxylate, ethyl 5-(furan-2-carboxamido)-3-methyl-4-thiocyanatothiophene-2-carboxylate, ethyl 4-(cyanosulfanyl)-5-(furan-2-amido)-3-methylthiophene-2-carboxylate, orb1219562, orb1308487, s9645, Ethyl 5-[(2-furanylcarbonyl)amino]-3-methyl-4-thiocyanato-2-thiophenecarboxylate, ethyl 5-(furan-2-carbonylamino)-3-methyl-4-thiocyanato-thiophene-2-carboxylate