cas: 678158-55-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
CLZ-8, 99.14% (CAS 678158-55-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 50 mg, 100 mg, 10 mg, 25 mg, 10mM/1mL, 5 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-122627-50 mg |
| cas | 678158-55-9 |
| opakowanie | 50 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 50 mg | 3189,68 Pln | |
| MedChemExpress | 100 mg | 4917,25 Pln | |
| MedChemExpress | 10 mg | 1081,31 Pln | |
| MedChemExpress | 25 mg | 2037,97 Pln | |
| MedChemExpress | 10mM/1mL | 751,58 Pln | |
| MedChemExpress | 5 mg | 695,86 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.14% |
(5Z)-2-[4-(2-hydroxyethyl)piperazin-1-yl]-5-[(4-phenylphenyl)methylidene]-1,3-thiazol-4-one (CAS 678158-55-9) to związek chemiczny o wzorze sumarycznym C22H23N3O2S i masie molowej 393.5 g/mol. Nazwa systematyczna IUPAC: (5Z)-2-[4-(2-hydroxyethyl)piperazin-1-yl]-5-[(4-phenylphenyl)methylidene]-1,3-thiazol-4-one. InChIKey: IBEWMFVUBLAYJT-SILNSSARSA-N.
| Wzór sumaryczny | C22H23N3O2S |
|---|---|
| Masa molowa | 393.5 g/mol |
| Nazwa IUPAC | (5Z)-2-[4-(2-hydroxyethyl)piperazin-1-yl]-5-[(4-phenylphenyl)methylidene]-1,3-thiazol-4-one |
| InChIKey | IBEWMFVUBLAYJT-SILNSSARSA-N |
| SMILES | C1CN(CCN1CCO)C2=NC(=O)/C(=C/C3=CC=C(C=C3)C4=CC=CC=C4)/S2 |
Dane obliczone przez PubChem (NCBI)